C19H33N7O5 — CID 122414757
(2S)-N-[(2S)-1-(2-aminoethylamino)-4-hydrazinyl-1-oxobutan-2-yl]-2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-3-methylbutanamide (PubChem CID 122414757) has the molecular formula C19H33N7O5 and a molecular weight of 439.52 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-(2-aminoethylamino)-4-hydrazinyl-1-oxobutan-2-yl]-2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-3-methylbutanamide.
| Compound Name | (2S)-N-[(2S)-1-(2-aminoethylamino)-4-hydrazinyl-1-oxobutan-2-yl]-2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 122414757 |
| Molecular Formula | C19H33N7O5 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (2S)-N-[(2S)-1-(2-aminoethylamino)-4-hydrazinyl-1-oxobutan-2-yl]-2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)CCCN1C(=O)C=CC1=O)C(=O)N[C@@H](CCNN)C(=O)NCCN |
| InChI | InChI=1S/C19H33N7O5/c1-12(2)17(19(31)24-13(7-9-23-21)18(30)22-10-8-20)25-14(27)4-3-11-26-15(28)5-6-16(26)29/h5-6,12-13,17,23H,3-4,7-11,20-21H2,1-2H3,(H,22,30)(H,24,31)(H,25,27)/t13-,17-/m0/s1 |
| InChIKey | AVTCARLFMOZZQA-GUYCJALGSA-N |
| XLogP | -2.75 |
| TPSA | 188.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|