C16H25NO2 — CID 122414790
3-(4-ethylphenoxy)-1-hydroxy-2,2,5,5-tetramethylpyrrolidine (PubChem CID 122414790) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 3-(4-ethylphenoxy)-1-hydroxy-2,2,5,5-tetramethylpyrrolidine.
| Compound Name | 3-(4-ethylphenoxy)-1-hydroxy-2,2,5,5-tetramethylpyrrolidine |
|---|---|
| PubChem CID | 122414790 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 3-(4-ethylphenoxy)-1-hydroxy-2,2,5,5-tetramethylpyrrolidine |
| SMILES | CCc1ccc(OC2CC(C)(C)N(O)C2(C)C)cc1 |
| InChI | InChI=1S/C16H25NO2/c1-6-12-7-9-13(10-8-12)19-14-11-15(2,3)17(18)16(14,4)5/h7-10,14,18H,6,11H2,1-5H3 |
| InChIKey | NSRGQTHWYNCACG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |