C35H70N2 — CID 122414899
2,2,7,7-tetramethyl-1-pentyl-4-[5-(2,2,7,7-tetramethyl-1-pentylazepan-4-yl)pentan-2-yl]azepane (PubChem CID 122414899) has the molecular formula C35H70N2 and a molecular weight of 518.96 g/mol. Its IUPAC name is 2,2,7,7-tetramethyl-1-pentyl-4-[5-(2,2,7,7-tetramethyl-1-pentylazepan-4-yl)pentan-2-yl]azepane.
| Compound Name | 2,2,7,7-tetramethyl-1-pentyl-4-[5-(2,2,7,7-tetramethyl-1-pentylazepan-4-yl)pentan-2-yl]azepane |
|---|---|
| PubChem CID | 122414899 |
| Molecular Formula | C35H70N2 |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.55 |
| IUPAC Name | 2,2,7,7-tetramethyl-1-pentyl-4-[5-(2,2,7,7-tetramethyl-1-pentylazepan-4-yl)pentan-2-yl]azepane |
| SMILES | CCCCCN1C(C)(C)CCC(CCCC(C)C2CCC(C)(C)N(CCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C35H70N2/c1-12-14-16-25-36-32(4,5)23-21-30(27-34(36,8)9)20-18-19-29(3)31-22-24-33(6,7)37(26-17-15-13-2)35(10,11)28-31/h29-31H,12-28H2,1-11H3 |
| InChIKey | MRMFTEMTVKXZHF-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|