C45H89N3 — CID 122415003
3-[1,3-bis(1-hexyl-2,2,5,5-tetramethylpyrrolidin-3-yl)propyl]-1-hexyl-2,2,5,5-tetramethylpyrrolidine (PubChem CID 122415003) has the molecular formula C45H89N3 and a molecular weight of 672.23 g/mol. Its IUPAC name is 3-[1,3-bis(1-hexyl-2,2,5,5-tetramethylpyrrolidin-3-yl)propyl]-1-hexyl-2,2,5,5-tetramethylpyrrolidine.
| Compound Name | 3-[1,3-bis(1-hexyl-2,2,5,5-tetramethylpyrrolidin-3-yl)propyl]-1-hexyl-2,2,5,5-tetramethylpyrrolidine |
|---|---|
| PubChem CID | 122415003 |
| Molecular Formula | C45H89N3 |
| Molecular Weight | 672.23 g/mol |
| Exact Mass | 671.71 |
| IUPAC Name | 3-[1,3-bis(1-hexyl-2,2,5,5-tetramethylpyrrolidin-3-yl)propyl]-1-hexyl-2,2,5,5-tetramethylpyrrolidine |
| SMILES | CCCCCCN1C(C)(C)CC(CCC(C2CC(C)(C)N(CCCCCC)C2(C)C)C2CC(C)(C)N(CCCCCC)C2(C)C)C1(C)C |
| InChI | InChI=1S/C45H89N3/c1-16-19-22-25-30-46-40(4,5)33-36(43(46,10)11)28-29-37(38-34-41(6,7)47(44(38,12)13)31-26-23-20-17-2)39-35-42(8,9)48(45(39,14)15)32-27-24-21-18-3/h36-39H,16-35H2,1-15H3 |
| InChIKey | PSBDOBDURRSYNM-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.23 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|