C39H63N3O6 — CID 122415009
tris(2,2,7,7-tetramethylazepan-4-yl) benzene-1,3,5-tricarboxylate (PubChem CID 122415009) has the molecular formula C39H63N3O6 and a molecular weight of 669.95 g/mol. Its IUPAC name is tris(2,2,7,7-tetramethylazepan-4-yl) benzene-1,3,5-tricarboxylate.
| Compound Name | tris(2,2,7,7-tetramethylazepan-4-yl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 122415009 |
| Molecular Formula | C39H63N3O6 |
| Molecular Weight | 669.95 g/mol |
| Exact Mass | 669.47 |
| IUPAC Name | tris(2,2,7,7-tetramethylazepan-4-yl) benzene-1,3,5-tricarboxylate |
| SMILES | CC1(C)CCC(OC(=O)c2cc(C(=O)OC3CCC(C)(C)NC(C)(C)C3)cc(C(=O)OC3CCC(C)(C)NC(C)(C)C3)c2)CC(C)(C)N1 |
| InChI | InChI=1S/C39H63N3O6/c1-34(2)16-13-28(22-37(7,8)40-34)46-31(43)25-19-26(32(44)47-29-14-17-35(3,4)41-38(9,10)23-29)21-27(20-25)33(45)48-30-15-18-36(5,6)42-39(11,12)24-30/h19-21,28-30,40-42H,13-18,22-24H2,1-12H3 |
| InChIKey | BTNNTLMRWZYRND-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.95 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|