C33H51N3O6 — CID 122415011
tris(2,2,5,5-tetramethylpyrrolidin-3-yl) benzene-1,3,5-tricarboxylate (PubChem CID 122415011) has the molecular formula C33H51N3O6 and a molecular weight of 585.79 g/mol. Its IUPAC name is tris(2,2,5,5-tetramethylpyrrolidin-3-yl) benzene-1,3,5-tricarboxylate.
| Compound Name | tris(2,2,5,5-tetramethylpyrrolidin-3-yl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 122415011 |
| Molecular Formula | C33H51N3O6 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.38 |
| IUPAC Name | tris(2,2,5,5-tetramethylpyrrolidin-3-yl) benzene-1,3,5-tricarboxylate |
| SMILES | CC1(C)CC(OC(=O)c2cc(C(=O)OC3CC(C)(C)NC3(C)C)cc(C(=O)OC3CC(C)(C)NC3(C)C)c2)C(C)(C)N1 |
| InChI | InChI=1S/C33H51N3O6/c1-28(2)16-22(31(7,8)34-28)40-25(37)19-13-20(26(38)41-23-17-29(3,4)35-32(23,9)10)15-21(14-19)27(39)42-24-18-30(5,6)36-33(24,11)12/h13-15,22-24,34-36H,16-18H2,1-12H3 |
| InChIKey | YFWDKLMGRGDBCR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|