C53H104N4O4 — CID 122415052
2,2,5,5-tetramethyl-1-propyl-3-[1,2,9-tris[(2,2,5,5-tetramethyl-1-propylpyrrolidin-3-yl)oxy]nonoxy]pyrrolidine (PubChem CID 122415052) has the molecular formula C53H104N4O4 and a molecular weight of 861.44 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-1-propyl-3-[1,2,9-tris[(2,2,5,5-tetramethyl-1-propylpyrrolidin-3-yl)oxy]nonoxy]pyrrolidine.
| Compound Name | 2,2,5,5-tetramethyl-1-propyl-3-[1,2,9-tris[(2,2,5,5-tetramethyl-1-propylpyrrolidin-3-yl)oxy]nonoxy]pyrrolidine |
|---|---|
| PubChem CID | 122415052 |
| Molecular Formula | C53H104N4O4 |
| Molecular Weight | 861.44 g/mol |
| Exact Mass | 860.81 |
| IUPAC Name | 2,2,5,5-tetramethyl-1-propyl-3-[1,2,9-tris[(2,2,5,5-tetramethyl-1-propylpyrrolidin-3-yl)oxy]nonoxy]pyrrolidine |
| SMILES | CCCN1C(C)(C)CC(OCCCCCCCC(OC2CC(C)(C)N(CCC)C2(C)C)C(OC2CC(C)(C)N(CCC)C2(C)C)OC2CC(C)(C)N(CCC)C2(C)C)C1(C)C |
| InChI | InChI=1S/C53H104N4O4/c1-21-31-54-46(5,6)36-41(50(54,13)14)58-35-29-27-25-26-28-30-40(59-42-37-47(7,8)55(32-22-2)51(42,15)16)45(60-43-38-48(9,10)56(33-23-3)52(43,17)18)61-44-39-49(11,12)57(34-24-4)53(44,19)20/h40-45H,21-39H2,1-20H3 |
| InChIKey | QDSRHKNVRXOQSH-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.44 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|