C56H86N4O8 — CID 122415075
[4-[2,4-bis[(2,2,7,7-tetramethylazepane-4-carbonyl)oxy]phenyl]-3-(2,2,7,7-tetramethylazepane-4-carbonyl)oxyphenyl] 2,2,7,7-tetramethylazepane-4-carboxylate (PubChem CID 122415075) has the molecular formula C56H86N4O8 and a molecular weight of 943.32 g/mol. Its IUPAC name is [4-[2,4-bis[(2,2,7,7-tetramethylazepane-4-carbonyl)oxy]phenyl]-3-(2,2,7,7-tetramethylazepane-4-carbonyl)oxyphenyl] 2,2,7,7-tetramethylazepane-4-carboxylate.
| Compound Name | [4-[2,4-bis[(2,2,7,7-tetramethylazepane-4-carbonyl)oxy]phenyl]-3-(2,2,7,7-tetramethylazepane-4-carbonyl)oxyphenyl] 2,2,7,7-tetramethylazepane-4-carboxylate |
|---|---|
| PubChem CID | 122415075 |
| Molecular Formula | C56H86N4O8 |
| Molecular Weight | 943.32 g/mol |
| Exact Mass | 942.64 |
| IUPAC Name | [4-[2,4-bis[(2,2,7,7-tetramethylazepane-4-carbonyl)oxy]phenyl]-3-(2,2,7,7-tetramethylazepane-4-carbonyl)oxyphenyl] 2,2,7,7-tetramethylazepane-4-carboxylate |
| SMILES | CC1(C)CCC(C(=O)Oc2ccc(-c3ccc(OC(=O)C4CCC(C)(C)NC(C)(C)C4)cc3OC(=O)C3CCC(C)(C)NC(C)(C)C3)c(OC(=O)C3CCC(C)(C)NC(C)(C)C3)c2)CC(C)(C)N1 |
| InChI | InChI=1S/C56H86N4O8/c1-49(2)25-21-35(31-53(9,10)57-49)45(61)65-39-17-19-41(43(29-39)67-47(63)37-23-27-51(5,6)59-55(13,14)33-37)42-20-18-40(66-46(62)36-22-26-50(3,4)58-54(11,12)32-36)30-44(42)68-48(64)38-24-28-52(7,8)60-56(15,16)34-38/h17-20,29-30,35-38,57-60H,21-28,31-34H2,1-16H3 |
| InChIKey | NIWVPXBKJBDUJO-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.32 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|