C36H49F3N2O4 — CID 122415108
(1-ethyl-2,2,5,5-tetramethylpyrrolidin-3-yl) 4-[4-(1-butyl-2,2,5,5-tetramethylpyrrolidin-3-yl)oxycarbonyl-2-fluorophenyl]-2,3-difluorobenzoate (PubChem CID 122415108) has the molecular formula C36H49F3N2O4 and a molecular weight of 630.79 g/mol. Its IUPAC name is (1-ethyl-2,2,5,5-tetramethylpyrrolidin-3-yl) 4-[4-(1-butyl-2,2,5,5-tetramethylpyrrolidin-3-yl)oxycarbonyl-2-fluorophenyl]-2,3-difluorobenzoate.
| Compound Name | (1-ethyl-2,2,5,5-tetramethylpyrrolidin-3-yl) 4-[4-(1-butyl-2,2,5,5-tetramethylpyrrolidin-3-yl)oxycarbonyl-2-fluorophenyl]-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 122415108 |
| Molecular Formula | C36H49F3N2O4 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.36 |
| IUPAC Name | (1-ethyl-2,2,5,5-tetramethylpyrrolidin-3-yl) 4-[4-(1-butyl-2,2,5,5-tetramethylpyrrolidin-3-yl)oxycarbonyl-2-fluorophenyl]-2,3-difluorobenzoate |
| SMILES | CCCCN1C(C)(C)CC(OC(=O)c2ccc(-c3ccc(C(=O)OC4CC(C)(C)N(CC)C4(C)C)c(F)c3F)c(F)c2)C1(C)C |
| InChI | InChI=1S/C36H49F3N2O4/c1-11-13-18-41-34(5,6)21-28(36(41,9)10)44-31(42)22-14-15-23(26(37)19-22)24-16-17-25(30(39)29(24)38)32(43)45-27-20-33(3,4)40(12-2)35(27,7)8/h14-17,19,27-28H,11-13,18,20-21H2,1-10H3 |
| InChIKey | ZJHHKXPZUGRBLF-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |