C18H22N2O3 — CID 122415289
2-[methyl-[(2R)-1-[4-(pyridin-3-ylmethoxy)phenyl]propan-2-yl]amino]acetic acid (PubChem CID 122415289) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-[methyl-[(2R)-1-[4-(pyridin-3-ylmethoxy)phenyl]propan-2-yl]amino]acetic acid.
| Compound Name | 2-[methyl-[(2R)-1-[4-(pyridin-3-ylmethoxy)phenyl]propan-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 122415289 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[methyl-[(2R)-1-[4-(pyridin-3-ylmethoxy)phenyl]propan-2-yl]amino]acetic acid |
| SMILES | C[C@H](Cc1ccc(OCc2cccnc2)cc1)N(C)CC(=O)O |
| InChI | InChI=1S/C18H22N2O3/c1-14(20(2)12-18(21)22)10-15-5-7-17(8-6-15)23-13-16-4-3-9-19-11-16/h3-9,11,14H,10,12-13H2,1-2H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | SJPOYBSZDVZWRP-CQSZACIVSA-N |
| XLogP | 2.61 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |