About 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid
2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid (PubChem CID 122415386) has the molecular formula C13H23NO4
and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid |
| PubChem CID | 122415386 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid |
| SMILES | C=CCOC(=O)N(CC(=O)O)C[C@@H](C)CC(C)C |
| InChI | InChI=1S/C13H23NO4/c1-5-6-18-13(17)14(9-12(15)16)8-11(4)7-10(2)3/h5,10-11H,1,6-9H2,2-4H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | STXIDPGHEZNZTI-NSHDSACASA-N |
| XLogP | 2.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid?
The IUPAC name of 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid (CID 122415386) is 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid.
What is the SMILES notation for 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid?
The canonical SMILES for 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid is C=CCOC(=O)N(CC(=O)O)C[C@@H](C)CC(C)C.
What is the InChIKey of 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid?
The InChIKey is STXIDPGHEZNZTI-NSHDSACASA-N. The full InChI is InChI=1S/C13H23NO4/c1-5-6-18-13(17)14(9-12(15)16)8-11(4)7-10(2)3/h5,10-11H,1,6-9H2,2-4H3,(H,15,16)/t11-/m0/s1.
What are the key properties of 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid?
2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid has a molecular weight of 257.33 g/mol, XLogP of 2.38, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-2,4-dimethylpentyl]-prop-2-enoxycarbonylamino]acetic acid is sourced from PubChem (CID 122415386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).