C12H22O4 — CID 122415434
1,5,5,11,11-pentamethyl-2,4,8,10-tetraoxaspiro[5.5]undecane (PubChem CID 122415434) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 1,5,5,11,11-pentamethyl-2,4,8,10-tetraoxaspiro[5.5]undecane.
| Compound Name | 1,5,5,11,11-pentamethyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 122415434 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1,5,5,11,11-pentamethyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
| SMILES | CC1OCOC(C)(C)C12COCOC2(C)C |
| InChI | InChI=1S/C12H22O4/c1-9-12(11(4,5)16-8-14-9)6-13-7-15-10(12,2)3/h9H,6-8H2,1-5H3 |
| InChIKey | QGAMFMGTAPPRQO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |