C11H22O2 — CID 122415442
2,2,4,4,5,6,6-heptamethyl-1,3-dioxane (PubChem CID 122415442) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 2,2,4,4,5,6,6-heptamethyl-1,3-dioxane.
| Compound Name | 2,2,4,4,5,6,6-heptamethyl-1,3-dioxane |
|---|---|
| PubChem CID | 122415442 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2,2,4,4,5,6,6-heptamethyl-1,3-dioxane |
| SMILES | CC1C(C)(C)OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C11H22O2/c1-8-9(2,3)12-11(6,7)13-10(8,4)5/h8H,1-7H3 |
| InChIKey | WFUVAXDYJXHNPY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |