C40H27N5O — CID 122416102
2-[3-(2-methoxypyrimidin-5-yl)-5-phenanthren-9-ylphenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 122416102) has the molecular formula C40H27N5O and a molecular weight of 593.69 g/mol. Its IUPAC name is 2-[3-(2-methoxypyrimidin-5-yl)-5-phenanthren-9-ylphenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(2-methoxypyrimidin-5-yl)-5-phenanthren-9-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 122416102 |
| Molecular Formula | C40H27N5O |
| Molecular Weight | 593.69 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | 2-[3-(2-methoxypyrimidin-5-yl)-5-phenanthren-9-ylphenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | COc1ncc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3cc4ccccc4c4ccccc34)c2)cn1 |
| InChI | InChI=1S/C40H27N5O/c1-46-40-41-24-32(25-42-40)29-20-30(36-23-28-16-8-9-17-33(28)34-18-10-11-19-35(34)36)22-31(21-29)39-44-37(26-12-4-2-5-13-26)43-38(45-39)27-14-6-3-7-15-27/h2-25H,1H3 |
| InChIKey | FDIQSWHHAHWDIP-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 73.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.69 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|