C57H39N7 — CID 122416173
2,4-bis[3-(6-methyl-2-pyridinyl)phenyl]-6-[3-phenanthren-9-yl-5-(6-pyridin-2-yl-3-pyridinyl)phenyl]-1,3,5-triazine (PubChem CID 122416173) has the molecular formula C57H39N7 and a molecular weight of 821.99 g/mol. Its IUPAC name is 2,4-bis[3-(6-methyl-2-pyridinyl)phenyl]-6-[3-phenanthren-9-yl-5-(6-pyridin-2-yl-3-pyridinyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis[3-(6-methyl-2-pyridinyl)phenyl]-6-[3-phenanthren-9-yl-5-(6-pyridin-2-yl-3-pyridinyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 122416173 |
| Molecular Formula | C57H39N7 |
| Molecular Weight | 821.99 g/mol |
| Exact Mass | 821.33 |
| IUPAC Name | 2,4-bis[3-(6-methyl-2-pyridinyl)phenyl]-6-[3-phenanthren-9-yl-5-(6-pyridin-2-yl-3-pyridinyl)phenyl]-1,3,5-triazine |
| SMILES | Cc1cccc(-c2cccc(-c3nc(-c4cccc(-c5cccc(C)n5)c4)nc(-c4cc(-c5ccc(-c6ccccn6)nc5)cc(-c5cc6ccccc6c6ccccc56)c4)n3)c2)n1 |
| InChI | InChI=1S/C57H39N7/c1-36-13-9-24-51(60-36)39-16-11-18-41(29-39)55-62-56(42-19-12-17-40(30-42)52-25-10-14-37(2)61-52)64-57(63-55)46-32-44(43-26-27-54(59-35-43)53-23-7-8-28-58-53)31-45(33-46)50-34-38-15-3-4-20-47(38)48-21-5-6-22-49(48)50/h3-35H,1-2H3 |
| InChIKey | PDPKAUMMPMYBOE-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.99 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|