C52H35N3 — CID 122416307
2-(9,9-diphenylfluoren-2-yl)-4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazine (PubChem CID 122416307) has the molecular formula C52H35N3 and a molecular weight of 701.87 g/mol. Its IUPAC name is 2-(9,9-diphenylfluoren-2-yl)-4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-diphenylfluoren-2-yl)-4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 122416307 |
| Molecular Formula | C52H35N3 |
| Molecular Weight | 701.87 g/mol |
| Exact Mass | 701.28 |
| IUPAC Name | 2-(9,9-diphenylfluoren-2-yl)-4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4-5)n3)c2)cc1 |
| InChI | InChI=1S/C52H35N3/c1-6-18-36(19-7-1)40-32-41(37-20-8-2-9-21-37)34-42(33-40)51-54-49(38-22-10-3-11-23-38)53-50(55-51)39-30-31-46-45-28-16-17-29-47(45)52(48(46)35-39,43-24-12-4-13-25-43)44-26-14-5-15-27-44/h1-35H |
| InChIKey | FMAAOIJJNLOPIK-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.87 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |