About ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate
ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate (PubChem CID 122416806) has the molecular formula C10H17F2NO2
and a molecular weight of 221.25 g/mol. Its IUPAC name is ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate |
| PubChem CID | 122416806 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate |
| SMILES | CCOC(=O)CC(C)C1CC(F)(F)CN1 |
| InChI | InChI=1S/C10H17F2NO2/c1-3-15-9(14)4-7(2)8-5-10(11,12)6-13-8/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | PWUSFTFEJYINHI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate?
The IUPAC name of ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate (CID 122416806) is ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate.
What is the SMILES notation for ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate?
The canonical SMILES for ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate is CCOC(=O)CC(C)C1CC(F)(F)CN1.
What is the InChIKey of ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate?
The InChIKey is PWUSFTFEJYINHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO2/c1-3-15-9(14)4-7(2)8-5-10(11,12)6-13-8/h7-8,13H,3-6H2,1-2H3.
What are the key properties of ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate?
ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate has a molecular weight of 221.25 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(4,4-difluoropyrrolidin-2-yl)butanoate is sourced from PubChem (CID 122416806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).