About ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate
ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate (PubChem CID 122416810) has the molecular formula C11H17F2NO2
and a molecular weight of 233.26 g/mol. Its IUPAC name is ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate |
| PubChem CID | 122416810 |
| Molecular Formula | C11H17F2NO2 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1CCC(F)(F)CN1C |
| InChI | InChI=1S/C11H17F2NO2/c1-3-16-10(15)5-4-9-6-7-11(12,13)8-14(9)2/h4-5,9H,3,6-8H2,1-2H3/b5-4+ |
| InChIKey | RIHXJGOKBVKRQD-SNAWJCMRSA-N |
| XLogP | 1.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate?
The IUPAC name of ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate (CID 122416810) is ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate.
What is the SMILES notation for ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate?
The canonical SMILES for ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate is CCOC(=O)/C=C/C1CCC(F)(F)CN1C.
What is the InChIKey of ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate?
The InChIKey is RIHXJGOKBVKRQD-SNAWJCMRSA-N. The full InChI is InChI=1S/C11H17F2NO2/c1-3-16-10(15)5-4-9-6-7-11(12,13)8-14(9)2/h4-5,9H,3,6-8H2,1-2H3/b5-4+.
What are the key properties of ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate?
ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate has a molecular weight of 233.26 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-3-(5,5-difluoro-1-methylpiperidin-2-yl)prop-2-enoate is sourced from PubChem (CID 122416810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).