About 4-methylidene-1,3-benzoxathiine
4-methylidene-1,3-benzoxathiine (PubChem CID 122417043) has the molecular formula C9H8OS
and a molecular weight of 164.23 g/mol. Its IUPAC name is 4-methylidene-1,3-benzoxathiine.
Molecular Properties
| Compound Name | 4-methylidene-1,3-benzoxathiine |
| PubChem CID | 122417043 |
| Molecular Formula | C9H8OS |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 4-methylidene-1,3-benzoxathiine |
| SMILES | C=C1SCOc2ccccc21 |
| InChI | InChI=1S/C9H8OS/c1-7-8-4-2-3-5-9(8)10-6-11-7/h2-5H,1,6H2 |
| InChIKey | QQRJZRDITKQTID-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylidene-1,3-benzoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-1,3-benzoxathiine?
The IUPAC name of 4-methylidene-1,3-benzoxathiine (CID 122417043) is 4-methylidene-1,3-benzoxathiine.
What is the SMILES notation for 4-methylidene-1,3-benzoxathiine?
The canonical SMILES for 4-methylidene-1,3-benzoxathiine is C=C1SCOc2ccccc21.
What is the InChIKey of 4-methylidene-1,3-benzoxathiine?
The InChIKey is QQRJZRDITKQTID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8OS/c1-7-8-4-2-3-5-9(8)10-6-11-7/h2-5H,1,6H2.
What are the key properties of 4-methylidene-1,3-benzoxathiine?
4-methylidene-1,3-benzoxathiine has a molecular weight of 164.23 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-1,3-benzoxathiine is sourced from PubChem (CID 122417043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).