About (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione
(5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione (PubChem CID 122417286) has the molecular formula C18H17NO2S
and a molecular weight of 311.41 g/mol. Its IUPAC name is (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione.
Molecular Properties
| Compound Name | (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione |
| PubChem CID | 122417286 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione |
| SMILES | C=C/C=C(\C=C/N)C(=O)CCC(=O)c1ccc2sccc2c1 |
| InChI | InChI=1S/C18H17NO2S/c1-2-3-13(8-10-19)16(20)5-6-17(21)14-4-7-18-15(12-14)9-11-22-18/h2-4,7-12H,1,5-6,19H2/b10-8-,13-3+ |
| InChIKey | IHSCRLWFNADMHD-GHHHTXJGSA-N |
| XLogP | 4.02 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione?
The IUPAC name of (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione (CID 122417286) is (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione.
What is the SMILES notation for (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione?
The canonical SMILES for (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione is C=C/C=C(\C=C/N)C(=O)CCC(=O)c1ccc2sccc2c1.
What is the InChIKey of (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione?
The InChIKey is IHSCRLWFNADMHD-GHHHTXJGSA-N. The full InChI is InChI=1S/C18H17NO2S/c1-2-3-13(8-10-19)16(20)5-6-17(21)14-4-7-18-15(12-14)9-11-22-18/h2-4,7-12H,1,5-6,19H2/b10-8-,13-3+.
What are the key properties of (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione?
(5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione has a molecular weight of 311.41 g/mol, XLogP of 4.02, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-[(Z)-2-aminoethenyl]-1-(1-benzothiophen-5-yl)octa-5,7-diene-1,4-dione is sourced from PubChem (CID 122417286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).