C25H35N3O2 — CID 122417502
tert-butyl 4-[(2-aminoanilino)methyl]-4-(2-phenylethyl)piperidine-1-carboxylate (PubChem CID 122417502) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is tert-butyl 4-[(2-aminoanilino)methyl]-4-(2-phenylethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-aminoanilino)methyl]-4-(2-phenylethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 122417502 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | tert-butyl 4-[(2-aminoanilino)methyl]-4-(2-phenylethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCc2ccccc2)(CNc2ccccc2N)CC1 |
| InChI | InChI=1S/C25H35N3O2/c1-24(2,3)30-23(29)28-17-15-25(16-18-28,14-13-20-9-5-4-6-10-20)19-27-22-12-8-7-11-21(22)26/h4-12,27H,13-19,26H2,1-3H3 |
| InChIKey | BSRZZGFSFMHDRC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|