C18H24O5S — CID 122417920
[(1R,2S,6R,7R,8S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl 4-methylbenzenesulfonate (PubChem CID 122417920) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is [(1R,2S,6R,7R,8S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,6R,7R,8S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 122417920 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | [(1R,2S,6R,7R,8S)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2C[C@@H]3C[C@H]2[C@H]2OC(C)(C)O[C@@H]32)cc1 |
| InChI | InChI=1S/C18H24O5S/c1-11-4-6-14(7-5-11)24(19,20)21-10-13-8-12-9-15(13)17-16(12)22-18(2,3)23-17/h4-7,12-13,15-17H,8-10H2,1-3H3/t12-,13-,15-,16+,17-/m1/s1 |
| InChIKey | LGXWIHSYKUPINT-LYHPXFHOSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|