About 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one
3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one (PubChem CID 122418498) has the molecular formula C21H28FNO
and a molecular weight of 329.46 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one |
| PubChem CID | 122418498 |
| Molecular Formula | C21H28FNO |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one |
| SMILES | CC(C)(C)c1cc(CCC(=O)c2ccc[nH]2)cc(C(C)(C)C)c1F |
| InChI | InChI=1S/C21H28FNO/c1-20(2,3)15-12-14(13-16(19(15)22)21(4,5)6)9-10-18(24)17-8-7-11-23-17/h7-8,11-13,23H,9-10H2,1-6H3 |
| InChIKey | PRJIJBXDJLEFFV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one?
The IUPAC name of 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one (CID 122418498) is 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one.
What is the SMILES notation for 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one?
The canonical SMILES for 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one is CC(C)(C)c1cc(CCC(=O)c2ccc[nH]2)cc(C(C)(C)C)c1F.
What is the InChIKey of 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one?
The InChIKey is PRJIJBXDJLEFFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28FNO/c1-20(2,3)15-12-14(13-16(19(15)22)21(4,5)6)9-10-18(24)17-8-7-11-23-17/h7-8,11-13,23H,9-10H2,1-6H3.
What are the key properties of 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one?
3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one has a molecular weight of 329.46 g/mol, XLogP of 5.56, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-ditert-butyl-4-fluorophenyl)-1-(1H-pyrrol-2-yl)propan-1-one is sourced from PubChem (CID 122418498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).