C43H65N3O7 — CID 122418711
3-O-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl) 1-O,7-O-bis(2,2,7,7-tetramethylazepan-4-yl) naphthalene-1,3,7-tricarboxylate (PubChem CID 122418711) has the molecular formula C43H65N3O7 and a molecular weight of 736.01 g/mol. Its IUPAC name is 3-O-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl) 1-O,7-O-bis(2,2,7,7-tetramethylazepan-4-yl) naphthalene-1,3,7-tricarboxylate.
| Compound Name | 3-O-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl) 1-O,7-O-bis(2,2,7,7-tetramethylazepan-4-yl) naphthalene-1,3,7-tricarboxylate |
|---|---|
| PubChem CID | 122418711 |
| Molecular Formula | C43H65N3O7 |
| Molecular Weight | 736.01 g/mol |
| Exact Mass | 735.48 |
| IUPAC Name | 3-O-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl) 1-O,7-O-bis(2,2,7,7-tetramethylazepan-4-yl) naphthalene-1,3,7-tricarboxylate |
| SMILES | CC1(C)CCC(OC(=O)c2ccc3cc(C(=O)OC4CCC(C)(C)N(O)C(C)(C)C4)cc(C(=O)OC4CCC(C)(C)NC(C)(C)C4)c3c2)CC(C)(C)N1 |
| InChI | InChI=1S/C43H65N3O7/c1-38(2)18-15-30(24-40(5,6)44-38)51-35(47)28-14-13-27-21-29(36(48)52-32-17-20-42(9,10)46(50)43(11,12)26-32)23-34(33(27)22-28)37(49)53-31-16-19-39(3,4)45-41(7,8)25-31/h13-14,21-23,30-32,44-45,50H,15-20,24-26H2,1-12H3 |
| InChIKey | FVVGOFKWUONBSJ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.01 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|