About N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine
N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine (PubChem CID 122419055) has the molecular formula C16H10N6S2
and a molecular weight of 350.43 g/mol. Its IUPAC name is N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine.
Molecular Properties
| Compound Name | N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine |
| PubChem CID | 122419055 |
| Molecular Formula | C16H10N6S2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine |
| SMILES | c1cnc2c(Nc3ccc4c(-c5ccsc5)nsc4c3)[nH]nc2n1 |
| InChI | InChI=1S/C16H10N6S2/c1-2-11-12(24-22-13(11)9-3-6-23-8-9)7-10(1)19-16-14-15(20-21-16)18-5-4-17-14/h1-8H,(H2,18,19,20,21) |
| InChIKey | NWIOCPGZWFLHDK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine?
The IUPAC name of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine (CID 122419055) is N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine.
What is the SMILES notation for N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine?
The canonical SMILES for N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine is c1cnc2c(Nc3ccc4c(-c5ccsc5)nsc4c3)[nH]nc2n1.
What is the InChIKey of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine?
The InChIKey is NWIOCPGZWFLHDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N6S2/c1-2-11-12(24-22-13(11)9-3-6-23-8-9)7-10(1)19-16-14-15(20-21-16)18-5-4-17-14/h1-8H,(H2,18,19,20,21).
What are the key properties of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine?
N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine has a molecular weight of 350.43 g/mol, XLogP of 4.43, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-thiophen-3-yl-1,2-benzothiazol-6-amine is sourced from PubChem (CID 122419055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).