C21H21N7OS — CID 122419142
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[6-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)-1,2-benzothiazol-3-yl]methanone (PubChem CID 122419142) has the molecular formula C21H21N7OS and a molecular weight of 419.51 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[6-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)-1,2-benzothiazol-3-yl]methanone.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[6-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)-1,2-benzothiazol-3-yl]methanone |
|---|---|
| PubChem CID | 122419142 |
| Molecular Formula | C21H21N7OS |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-[6-(1H-pyrazolo[4,3-b]pyridin-3-ylamino)-1,2-benzothiazol-3-yl]methanone |
| SMILES | O=C(c1nsc2cc(Nc3n[nH]c4cccnc34)ccc12)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C21H21N7OS/c29-21(28-10-9-27-8-2-3-14(27)12-28)18-15-6-5-13(11-17(15)30-26-18)23-20-19-16(24-25-20)4-1-7-22-19/h1,4-7,11,14H,2-3,8-10,12H2,(H2,23,24,25) |
| InChIKey | DHZNLONDPJWGQX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |