C24H27FN2O7S — CID 122420656
[(1aR,7bS)-5-[[2-[[(3R)-1-ethylpyrrolidin-3-yl]oxymethyl]-4-fluorophenyl]sulfonylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromen-4-yl] hydrogen carbonate (PubChem CID 122420656) has the molecular formula C24H27FN2O7S and a molecular weight of 506.55 g/mol. Its IUPAC name is [(1aR,7bS)-5-[[2-[[(3R)-1-ethylpyrrolidin-3-yl]oxymethyl]-4-fluorophenyl]sulfonylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromen-4-yl] hydrogen carbonate.
| Compound Name | [(1aR,7bS)-5-[[2-[[(3R)-1-ethylpyrrolidin-3-yl]oxymethyl]-4-fluorophenyl]sulfonylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromen-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 122420656 |
| Molecular Formula | C24H27FN2O7S |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | [(1aR,7bS)-5-[[2-[[(3R)-1-ethylpyrrolidin-3-yl]oxymethyl]-4-fluorophenyl]sulfonylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromen-4-yl] hydrogen carbonate |
| SMILES | CCN1CC[C@@H](OCc2cc(F)ccc2S(=O)(=O)Nc2ccc3c(c2OC(=O)O)OC[C@@H]2C[C@H]32)C1 |
| InChI | InChI=1S/C24H27FN2O7S/c1-2-27-8-7-17(11-27)32-13-15-9-16(25)3-6-21(15)35(30,31)26-20-5-4-18-19-10-14(19)12-33-22(18)23(20)34-24(28)29/h3-6,9,14,17,19,26H,2,7-8,10-13H2,1H3,(H,28,29)/t14-,17+,19-/m0/s1 |
| InChIKey | ADUJVWCMEQYNRC-YJLNNSPDSA-N |
| XLogP | 3.79 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|