C19H14F4N6O — CID 122420882
6-(6-fluoro-2-methylbenzimidazol-1-yl)-3-hydroxy-2-[4-(trifluoromethyl)phenyl]iminopyrimidin-4-amine (PubChem CID 122420882) has the molecular formula C19H14F4N6O and a molecular weight of 418.35 g/mol. Its IUPAC name is 6-(6-fluoro-2-methylbenzimidazol-1-yl)-3-hydroxy-2-[4-(trifluoromethyl)phenyl]iminopyrimidin-4-amine.
| Compound Name | 6-(6-fluoro-2-methylbenzimidazol-1-yl)-3-hydroxy-2-[4-(trifluoromethyl)phenyl]iminopyrimidin-4-amine |
|---|---|
| PubChem CID | 122420882 |
| Molecular Formula | C19H14F4N6O |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 6-(6-fluoro-2-methylbenzimidazol-1-yl)-3-hydroxy-2-[4-(trifluoromethyl)phenyl]iminopyrimidin-4-amine |
| SMILES | Cc1nc2ccc(F)cc2n1-c1cc(N)n(O)/c(=N\c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C19H14F4N6O/c1-10-25-14-7-4-12(20)8-15(14)28(10)17-9-16(24)29(30)18(27-17)26-13-5-2-11(3-6-13)19(21,22)23/h2-9,30H,24H2,1H3/b26-18- |
| InChIKey | XWKISCJAKCQHOU-ITYLOYPMSA-N |
| XLogP | 3.74 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|