C10H12FN3O3S — CID 122420974
4-fluoro-2-[4-[(Z)-hydroxyiminomethyl]-1,3-thiazol-2-yl]piperidine-1-carboxylic acid (PubChem CID 122420974) has the molecular formula C10H12FN3O3S and a molecular weight of 273.29 g/mol. Its IUPAC name is 4-fluoro-2-[4-[(Z)-hydroxyiminomethyl]-1,3-thiazol-2-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-fluoro-2-[4-[(Z)-hydroxyiminomethyl]-1,3-thiazol-2-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 122420974 |
| Molecular Formula | C10H12FN3O3S |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 4-fluoro-2-[4-[(Z)-hydroxyiminomethyl]-1,3-thiazol-2-yl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(F)CC1c1nc(/C=N\O)cs1 |
| InChI | InChI=1S/C10H12FN3O3S/c11-6-1-2-14(10(15)16)8(3-6)9-13-7(4-12-17)5-18-9/h4-6,8,17H,1-3H2,(H,15,16)/b12-4- |
| InChIKey | GUDYYPXGWIFMRU-QCDXTXTGSA-N |
| XLogP | 2.10 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|