C25H21N5O — CID 122421275
N-[3-[3-(2-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide (PubChem CID 122421275) has the molecular formula C25H21N5O and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[3-[3-(2-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[3-(2-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122421275 |
| Molecular Formula | C25H21N5O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[3-[3-(2-ethyl-1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cnc3[nH]cc(-c4ccnc5[nH]c(CC)cc45)c3c2)c1 |
| InChI | InChI=1S/C25H21N5O/c1-3-17-12-21-19(8-9-26-25(21)30-17)22-14-28-24-20(22)11-16(13-27-24)15-6-5-7-18(10-15)29-23(31)4-2/h4-14H,2-3H2,1H3,(H,26,30)(H,27,28)(H,29,31) |
| InChIKey | OPIVTEQQTBWONN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|