C26H24N6O — CID 122421375
(E)-4-(dimethylamino)-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-enamide (PubChem CID 122421375) has the molecular formula C26H24N6O and a molecular weight of 436.52 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 122421375 |
| Molecular Formula | C26H24N6O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1cccc(-c2cnc3[nH]cc(-c4ccnc5[nH]ccc45)c3c2)c1 |
| InChI | InChI=1S/C26H24N6O/c1-32(2)12-4-7-24(33)31-19-6-3-5-17(13-19)18-14-22-23(16-30-26(22)29-15-18)20-8-10-27-25-21(20)9-11-28-25/h3-11,13-16H,12H2,1-2H3,(H,27,28)(H,29,30)(H,31,33)/b7-4+ |
| InChIKey | UUWQVTOGSYPYMK-QPJJXVBHSA-N |
| XLogP | 4.83 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|