C23H17N5O — CID 122421544
N-[3-[3-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide (PubChem CID 122421544) has the molecular formula C23H17N5O and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[3-[3-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[3-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122421544 |
| Molecular Formula | C23H17N5O |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[3-[3-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cnc3[nH]cc(-c4cncc5[nH]ccc45)c3c2)c1 |
| InChI | InChI=1S/C23H17N5O/c1-2-22(29)28-16-5-3-4-14(8-16)15-9-18-20(12-27-23(18)26-10-15)19-11-24-13-21-17(19)6-7-25-21/h2-13,25H,1H2,(H,26,27)(H,28,29) |
| InChIKey | WBELHBNYYUHXHT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|