C25H19N5O2 — CID 122421604
4-methoxy-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide (PubChem CID 122421604) has the molecular formula C25H19N5O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is 4-methoxy-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide.
| Compound Name | 4-methoxy-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 122421604 |
| Molecular Formula | C25H19N5O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-methoxy-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide |
| SMILES | COCC#CC(=O)Nc1cccc(-c2cnc3[nH]cc(-c4ccnc5[nH]ccc45)c3c2)c1 |
| InChI | InChI=1S/C25H19N5O2/c1-32-11-3-6-23(31)30-18-5-2-4-16(12-18)17-13-21-22(15-29-25(21)28-14-17)19-7-9-26-24-20(19)8-10-27-24/h2,4-5,7-10,12-15H,11H2,1H3,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | FZCJADNSMYYINT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|