C24H17N5O — CID 122421636
N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide (PubChem CID 122421636) has the molecular formula C24H17N5O and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide.
| Compound Name | N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 122421636 |
| Molecular Formula | C24H17N5O |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1cccc(-c2cnc3[nH]cc(-c4ccnc5[nH]ccc45)c3c2)c1 |
| InChI | InChI=1S/C24H17N5O/c1-2-4-22(30)29-17-6-3-5-15(11-17)16-12-20-21(14-28-24(20)27-13-16)18-7-9-25-23-19(18)8-10-26-23/h3,5-14H,1H3,(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | DWHQIGWSGQLCOU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|