C24H17N5O2 — CID 122421751
4-hydroxy-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide (PubChem CID 122421751) has the molecular formula C24H17N5O2 and a molecular weight of 407.43 g/mol. Its IUPAC name is 4-hydroxy-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide.
| Compound Name | 4-hydroxy-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 122421751 |
| Molecular Formula | C24H17N5O2 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-hydroxy-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-ynamide |
| SMILES | O=C(C#CCO)Nc1cccc(-c2cnc3[nH]cc(-c4ccnc5[nH]ccc45)c3c2)c1 |
| InChI | InChI=1S/C24H17N5O2/c30-10-2-5-22(31)29-17-4-1-3-15(11-17)16-12-20-21(14-28-24(20)27-13-16)18-6-8-25-23-19(18)7-9-26-23/h1,3-4,6-9,11-14,30H,10H2,(H,25,26)(H,27,28)(H,29,31) |
| InChIKey | LKXSIXGEKQKQOY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|