C25H22N6O — CID 122421767
(E)-4-(methylamino)-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-enamide (PubChem CID 122421767) has the molecular formula C25H22N6O and a molecular weight of 422.49 g/mol. Its IUPAC name is (E)-4-(methylamino)-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-enamide.
| Compound Name | (E)-4-(methylamino)-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 122421767 |
| Molecular Formula | C25H22N6O |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (E)-4-(methylamino)-N-[3-[3-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenyl]but-2-enamide |
| SMILES | CNC/C=C/C(=O)Nc1cccc(-c2cnc3[nH]cc(-c4ccnc5[nH]ccc45)c3c2)c1 |
| InChI | InChI=1S/C25H22N6O/c1-26-9-3-6-23(32)31-18-5-2-4-16(12-18)17-13-21-22(15-30-25(21)29-14-17)19-7-10-27-24-20(19)8-11-28-24/h2-8,10-15,26H,9H2,1H3,(H,27,28)(H,29,30)(H,31,32)/b6-3+ |
| InChIKey | NSXVCXYGFVBLRE-ZZXKWVIFSA-N |
| XLogP | 4.49 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|