C22H22N4O3S — CID 1224219
N-(2,6-dimethylpyrimidin-4-yl)-4-[[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]amino]benzenesulfonamide (PubChem CID 1224219) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-(2,6-dimethylpyrimidin-4-yl)-4-[[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]amino]benzenesulfonamide.
| Compound Name | N-(2,6-dimethylpyrimidin-4-yl)-4-[[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 1224219 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-(2,6-dimethylpyrimidin-4-yl)-4-[[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]amino]benzenesulfonamide |
| SMILES | Cc1ccc(C(=O)/C=C/Nc2ccc(S(=O)(=O)Nc3cc(C)nc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C22H22N4O3S/c1-15-4-6-18(7-5-15)21(27)12-13-23-19-8-10-20(11-9-19)30(28,29)26-22-14-16(2)24-17(3)25-22/h4-14,23H,1-3H3,(H,24,25,26)/b13-12+ |
| InChIKey | CPCOKAFJUKNION-OUKQBFOZSA-N |
| XLogP | 4.01 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|