C27H24ClNO3 — CID 122422026
2-chloro-5-[3-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]naphthalen-1-yl]benzoic acid (PubChem CID 122422026) has the molecular formula C27H24ClNO3 and a molecular weight of 445.95 g/mol. Its IUPAC name is 2-chloro-5-[3-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]naphthalen-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[3-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]naphthalen-1-yl]benzoic acid |
|---|---|
| PubChem CID | 122422026 |
| Molecular Formula | C27H24ClNO3 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-chloro-5-[3-[[[(1R)-1-(3-methoxyphenyl)ethyl]amino]methyl]naphthalen-1-yl]benzoic acid |
| SMILES | COc1cccc([C@@H](C)NCc2cc(-c3ccc(Cl)c(C(=O)O)c3)c3ccccc3c2)c1 |
| InChI | InChI=1S/C27H24ClNO3/c1-17(19-7-5-8-22(14-19)32-2)29-16-18-12-20-6-3-4-9-23(20)24(13-18)21-10-11-26(28)25(15-21)27(30)31/h3-15,17,29H,16H2,1-2H3,(H,30,31)/t17-/m1/s1 |
| InChIKey | OBKFXYWNGGJYAW-QGZVFWFLSA-N |
| XLogP | 6.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |