C5HF7O2 — CID 122422321
1,1,2,2-tetrafluoroethene;3,4,5-trifluoro-3H-dioxole (PubChem CID 122422321) has the molecular formula C5HF7O2 and a molecular weight of 226.05 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoroethene;3,4,5-trifluoro-3H-dioxole.
| Compound Name | 1,1,2,2-tetrafluoroethene;3,4,5-trifluoro-3H-dioxole |
|---|---|
| PubChem CID | 122422321 |
| Molecular Formula | C5HF7O2 |
| Molecular Weight | 226.05 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 1,1,2,2-tetrafluoroethene;3,4,5-trifluoro-3H-dioxole |
| SMILES | FC(F)=C(F)F.FC1=C(F)C(F)OO1 |
| InChI | InChI=1S/C3HF3O2.C2F4/c4-1-2(5)7-8-3(1)6;3-1(4)2(5)6/h2H; |
| InChIKey | UDBLLLNATLZJKI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.05 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|