C16H13F4NO4S — CID 122422467
3-methylsulfonyl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide (PubChem CID 122422467) has the molecular formula C16H13F4NO4S and a molecular weight of 391.34 g/mol. Its IUPAC name is 3-methylsulfonyl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide.
| Compound Name | 3-methylsulfonyl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 122422467 |
| Molecular Formula | C16H13F4NO4S |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 3-methylsulfonyl-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]benzamide |
| SMILES | CS(=O)(=O)c1cc(C(N)=O)ccc1-c1ccc(OC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C16H13F4NO4S/c1-26(23,24)13-8-10(14(21)22)4-7-12(13)9-2-5-11(6-3-9)25-16(19,20)15(17)18/h2-8,15H,1H3,(H2,21,22) |
| InChIKey | VNBDPWFBLLOSSF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|