About 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide
3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide (PubChem CID 122422529) has the molecular formula C16H14F3NO4S
and a molecular weight of 373.35 g/mol. Its IUPAC name is 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide.
Molecular Properties
| Compound Name | 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide |
| PubChem CID | 122422529 |
| Molecular Formula | C16H14F3NO4S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide |
| SMILES | CS(=O)(=O)c1cc(C(N)=O)ccc1-c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3NO4S/c1-25(22,23)14-8-11(15(20)21)4-7-13(14)10-2-5-12(6-3-10)24-9-16(17,18)19/h2-8H,9H2,1H3,(H2,20,21) |
| InChIKey | ZMZNHOVPKRPSPP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide?
The IUPAC name of 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide (CID 122422529) is 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide.
What is the SMILES notation for 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide?
The canonical SMILES for 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide is CS(=O)(=O)c1cc(C(N)=O)ccc1-c1ccc(OCC(F)(F)F)cc1.
What is the InChIKey of 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide?
The InChIKey is ZMZNHOVPKRPSPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3NO4S/c1-25(22,23)14-8-11(15(20)21)4-7-13(14)10-2-5-12(6-3-10)24-9-16(17,18)19/h2-8H,9H2,1H3,(H2,20,21).
What are the key properties of 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide?
3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide has a molecular weight of 373.35 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfonyl-4-[4-(2,2,2-trifluoroethoxy)phenyl]benzamide is sourced from PubChem (CID 122422529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).