C34H38ClN5O4S — CID 122422729
3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]-N-pyridin-3-ylsulfonylpropanamide (PubChem CID 122422729) has the molecular formula C34H38ClN5O4S and a molecular weight of 648.23 g/mol. Its IUPAC name is 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]-N-pyridin-3-ylsulfonylpropanamide.
| Compound Name | 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]-N-pyridin-3-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 122422729 |
| Molecular Formula | C34H38ClN5O4S |
| Molecular Weight | 648.23 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-methyl-7-(1,3,5-trimethylpyrazol-4-yl)indol-1-yl]-N-pyridin-3-ylsulfonylpropanamide |
| SMILES | Cc1cc(OCCCc2c(C)n(CCC(=O)NS(=O)(=O)c3cccnc3)c3c(-c4c(C)nn(C)c4C)cccc23)cc(C)c1Cl |
| InChI | InChI=1S/C34H38ClN5O4S/c1-21-18-26(19-22(2)33(21)35)44-17-9-13-28-24(4)40(16-14-31(41)38-45(42,43)27-10-8-15-36-20-27)34-29(28)11-7-12-30(34)32-23(3)37-39(6)25(32)5/h7-8,10-12,15,18-20H,9,13-14,16-17H2,1-6H3,(H,38,41) |
| InChIKey | FEJNWLMWZZVHAD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.23 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|