C31H39ClN4O4S — CID 122422731
3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-methylindol-1-yl]-N-methylsulfonylpropanamide (PubChem CID 122422731) has the molecular formula C31H39ClN4O4S and a molecular weight of 599.20 g/mol. Its IUPAC name is 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-methylindol-1-yl]-N-methylsulfonylpropanamide.
| Compound Name | 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-methylindol-1-yl]-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 122422731 |
| Molecular Formula | C31H39ClN4O4S |
| Molecular Weight | 599.20 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 3-[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1-ethyl-3,5-dimethylpyrazol-4-yl)-2-methylindol-1-yl]-N-methylsulfonylpropanamide |
| SMILES | CCn1nc(C)c(-c2cccc3c(CCCOc4cc(C)c(Cl)c(C)c4)c(C)n(CCC(=O)NS(C)(=O)=O)c23)c1C |
| InChI | InChI=1S/C31H39ClN4O4S/c1-8-36-23(6)29(21(4)33-36)27-12-9-11-26-25(13-10-16-40-24-17-19(2)30(32)20(3)18-24)22(5)35(31(26)27)15-14-28(37)34-41(7,38)39/h9,11-12,17-18H,8,10,13-16H2,1-7H3,(H,34,37) |
| InChIKey | POFOPFGZYSAHPW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.20 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|