About [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate
[2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate (PubChem CID 122422765) has the molecular formula C27H35N3O3
and a molecular weight of 449.60 g/mol. Its IUPAC name is [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate.
Molecular Properties
| Compound Name | [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate |
| PubChem CID | 122422765 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate |
| SMILES | CC(C)C(Cc1ccccc1)(OC(N)=O)C(=O)N1CC2CC(CN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C27H35N3O3/c1-20(2)27(33-26(28)32,14-21-9-5-3-6-10-21)25(31)30-18-23-13-24(19-30)17-29(16-23)15-22-11-7-4-8-12-22/h3-12,20,23-24H,13-19H2,1-2H3,(H2,28,32) |
| InChIKey | QPOVQDWGJAORDI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate?
The IUPAC name of [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate (CID 122422765) is [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate.
What is the SMILES notation for [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate?
The canonical SMILES for [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate is CC(C)C(Cc1ccccc1)(OC(N)=O)C(=O)N1CC2CC(CN(Cc3ccccc3)C2)C1.
What is the InChIKey of [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate?
The InChIKey is QPOVQDWGJAORDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35N3O3/c1-20(2)27(33-26(28)32,14-21-9-5-3-6-10-21)25(31)30-18-23-13-24(19-30)17-29(16-23)15-22-11-7-4-8-12-22/h3-12,20,23-24H,13-19H2,1-2H3,(H2,28,32).
What are the key properties of [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate?
[2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate has a molecular weight of 449.60 g/mol, XLogP of 3.70, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-benzyl-1-(7-benzyl-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3-methyl-1-oxobutan-2-yl] carbamate is sourced from PubChem (CID 122422765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).