About heptan-2-yl 4-fluoro-3-methylbenzoate
heptan-2-yl 4-fluoro-3-methylbenzoate (PubChem CID 122423278) has the molecular formula C15H21FO2
and a molecular weight of 252.33 g/mol. Its IUPAC name is heptan-2-yl 4-fluoro-3-methylbenzoate.
Molecular Properties
| Compound Name | heptan-2-yl 4-fluoro-3-methylbenzoate |
| PubChem CID | 122423278 |
| Molecular Formula | C15H21FO2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | heptan-2-yl 4-fluoro-3-methylbenzoate |
| SMILES | CCCCCC(C)OC(=O)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C15H21FO2/c1-4-5-6-7-12(3)18-15(17)13-8-9-14(16)11(2)10-13/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | IUKDRNIYMFXLQY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-yl 4-fluoro-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-yl 4-fluoro-3-methylbenzoate?
The IUPAC name of heptan-2-yl 4-fluoro-3-methylbenzoate (CID 122423278) is heptan-2-yl 4-fluoro-3-methylbenzoate.
What is the SMILES notation for heptan-2-yl 4-fluoro-3-methylbenzoate?
The canonical SMILES for heptan-2-yl 4-fluoro-3-methylbenzoate is CCCCCC(C)OC(=O)c1ccc(F)c(C)c1.
What is the InChIKey of heptan-2-yl 4-fluoro-3-methylbenzoate?
The InChIKey is IUKDRNIYMFXLQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FO2/c1-4-5-6-7-12(3)18-15(17)13-8-9-14(16)11(2)10-13/h8-10,12H,4-7H2,1-3H3.
What are the key properties of heptan-2-yl 4-fluoro-3-methylbenzoate?
heptan-2-yl 4-fluoro-3-methylbenzoate has a molecular weight of 252.33 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-yl 4-fluoro-3-methylbenzoate is sourced from PubChem (CID 122423278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).