About 3-methylsulfanyldecanal
3-methylsulfanyldecanal (PubChem CID 122423559) has the molecular formula C11H22OS
and a molecular weight of 202.36 g/mol. Its IUPAC name is 3-methylsulfanyldecanal.
Molecular Properties
| Compound Name | 3-methylsulfanyldecanal |
| PubChem CID | 122423559 |
| Molecular Formula | C11H22OS |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 3-methylsulfanyldecanal |
| SMILES | CCCCCCCC(CC=O)SC |
| InChI | InChI=1S/C11H22OS/c1-3-4-5-6-7-8-11(13-2)9-10-12/h10-11H,3-9H2,1-2H3 |
| InChIKey | WZRMFIROSHXUJB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfanyldecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanyldecanal?
The IUPAC name of 3-methylsulfanyldecanal (CID 122423559) is 3-methylsulfanyldecanal.
What is the SMILES notation for 3-methylsulfanyldecanal?
The canonical SMILES for 3-methylsulfanyldecanal is CCCCCCCC(CC=O)SC.
What is the InChIKey of 3-methylsulfanyldecanal?
The InChIKey is WZRMFIROSHXUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22OS/c1-3-4-5-6-7-8-11(13-2)9-10-12/h10-11H,3-9H2,1-2H3.
What are the key properties of 3-methylsulfanyldecanal?
3-methylsulfanyldecanal has a molecular weight of 202.36 g/mol, XLogP of 3.67, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanyldecanal is sourced from PubChem (CID 122423559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).