C26H29Br2N5O4 — CID 122423750
7-[(6,8-dibromoisoquinolin-5-yl)oxymethyl]-6-(5-hydroxypentyl)-3-methyl-1-(2-methylpropyl)pteridine-2,4-dione (PubChem CID 122423750) has the molecular formula C26H29Br2N5O4 and a molecular weight of 635.36 g/mol. Its IUPAC name is 7-[(6,8-dibromoisoquinolin-5-yl)oxymethyl]-6-(5-hydroxypentyl)-3-methyl-1-(2-methylpropyl)pteridine-2,4-dione.
| Compound Name | 7-[(6,8-dibromoisoquinolin-5-yl)oxymethyl]-6-(5-hydroxypentyl)-3-methyl-1-(2-methylpropyl)pteridine-2,4-dione |
|---|---|
| PubChem CID | 122423750 |
| Molecular Formula | C26H29Br2N5O4 |
| Molecular Weight | 635.36 g/mol |
| Exact Mass | 633.06 |
| IUPAC Name | 7-[(6,8-dibromoisoquinolin-5-yl)oxymethyl]-6-(5-hydroxypentyl)-3-methyl-1-(2-methylpropyl)pteridine-2,4-dione |
| SMILES | CC(C)Cn1c(=O)n(C)c(=O)c2nc(CCCCCO)c(COc3c(Br)cc(Br)c4cnccc34)nc21 |
| InChI | InChI=1S/C26H29Br2N5O4/c1-15(2)13-33-24-22(25(35)32(3)26(33)36)30-20(7-5-4-6-10-34)21(31-24)14-37-23-16-8-9-29-12-17(16)18(27)11-19(23)28/h8-9,11-12,15,34H,4-7,10,13-14H2,1-3H3 |
| InChIKey | JELIXQBORFHDGB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|