C28H31Br2N5O5 — CID 122423771
5-[7-[(6,8-dibromoisoquinolin-5-yl)oxymethyl]-3-methyl-1-(2-methylpropyl)-2,4-dioxopteridin-6-yl]pentyl acetate (PubChem CID 122423771) has the molecular formula C28H31Br2N5O5 and a molecular weight of 677.39 g/mol. Its IUPAC name is 5-[7-[(6,8-dibromoisoquinolin-5-yl)oxymethyl]-3-methyl-1-(2-methylpropyl)-2,4-dioxopteridin-6-yl]pentyl acetate.
| Compound Name | 5-[7-[(6,8-dibromoisoquinolin-5-yl)oxymethyl]-3-methyl-1-(2-methylpropyl)-2,4-dioxopteridin-6-yl]pentyl acetate |
|---|---|
| PubChem CID | 122423771 |
| Molecular Formula | C28H31Br2N5O5 |
| Molecular Weight | 677.39 g/mol |
| Exact Mass | 675.07 |
| IUPAC Name | 5-[7-[(6,8-dibromoisoquinolin-5-yl)oxymethyl]-3-methyl-1-(2-methylpropyl)-2,4-dioxopteridin-6-yl]pentyl acetate |
| SMILES | CC(=O)OCCCCCc1nc2c(=O)n(C)c(=O)n(CC(C)C)c2nc1COc1c(Br)cc(Br)c2cnccc12 |
| InChI | InChI=1S/C28H31Br2N5O5/c1-16(2)14-35-26-24(27(37)34(4)28(35)38)32-22(8-6-5-7-11-39-17(3)36)23(33-26)15-40-25-18-9-10-31-13-19(18)20(29)12-21(25)30/h9-10,12-13,16H,5-8,11,14-15H2,1-4H3 |
| InChIKey | OTFIBJUZUWWRJT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 118.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|