C23H17ClN6O4 — CID 122424175
4-[[3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium-7-carbonyl]amino]benzoic acid (PubChem CID 122424175) has the molecular formula C23H17ClN6O4 and a molecular weight of 476.88 g/mol. Its IUPAC name is 4-[[3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium-7-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium-7-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 122424175 |
| Molecular Formula | C23H17ClN6O4 |
| Molecular Weight | 476.88 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 4-[[3-[5-chloro-2-(tetrazol-1-yl)phenyl]-1-oxido-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium-7-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C2CCc3cc(-c4cc(Cl)ccc4-n4cnnn4)c[n+]([O-])c32)cc1 |
| InChI | InChI=1S/C23H17ClN6O4/c24-16-4-8-20(29-12-25-27-28-29)19(10-16)15-9-14-3-7-18(21(14)30(34)11-15)22(31)26-17-5-1-13(2-6-17)23(32)33/h1-2,4-6,8-12,18H,3,7H2,(H,26,31)(H,32,33) |
| InChIKey | AKJAQNYBFISUTH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 136.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.88 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|