C12H15ClN2O2S — CID 122424400
4-[(2-chloro-3-pyridinyl)sulfanylmethyl]piperidine-1-carboxylic acid (PubChem CID 122424400) has the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. Its IUPAC name is 4-[(2-chloro-3-pyridinyl)sulfanylmethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[(2-chloro-3-pyridinyl)sulfanylmethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 122424400 |
| Molecular Formula | C12H15ClN2O2S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 4-[(2-chloro-3-pyridinyl)sulfanylmethyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(CSc2cccnc2Cl)CC1 |
| InChI | InChI=1S/C12H15ClN2O2S/c13-11-10(2-1-5-14-11)18-8-9-3-6-15(7-4-9)12(16)17/h1-2,5,9H,3-4,6-8H2,(H,16,17) |
| InChIKey | DKRIDYRBFILLJJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|